alexavolis alexavolis

03-05-2022
Mathematics

contestada

How many times greater is 8.4 x 109 than 1.5 × 10²?

Respuesta :

03-05-2022

Answer:

900.6 times greater!

Step-by-step explanation:

8.4 x 109 = 915.6

10 by the power of 2 is 100 so;

1.5 x 100 = 15

915.6 > 15

915.6 - 15 = 900.6

Answer Link

Otras preguntas

uestion 5BROOKLYN LTD has developed a new product and is currently considering the marketing and pricingpolicy it should employ for this. Specifically, it is co

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Write the equation for the line that passes through the points (4, 5) and (6,9). *

Angle A corresponds to angle____ B C E D none of the above

Create a scatterplot for the following population data, using t = 0 to stand for 1950. Then estimate the population of Namibia in the years 1940, 1997, and 2005

What nursing theory states ""Knowledge as a component of the sociocultural orientation basic conditioning factor enhances prevention of hazards""?

Create a figure with half the perimeter of a given figure. you don't have to actually make a shape, can someone explain how to do this pls

the degradation of glycogen is promoted by what

What is the value of the 6 in 13.76?

Shelby Organic Foods is a fast growing firm that produces organic frozen food entrees.The firm employs 700 people and expects to hire more in the next few years