raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

Write a causal question based on the information in the passage
plsssss help me. Write the equation of the parabola given the following information: Directrix: x=6 Focus (2,0)
write a summary that describes what occurred in canada in the 1900's to help them grow and succeed.
If each of two complementary angles has the same measure, then each angle will equal _____. 22.5° 90° 180° 45°
Is 45 a multiple of 4? Explain your answer Lmk ASAP
Do you believe there is any way in which bullying can be stopped,lessened, or prevented?
1. List two government approaches that restrict drinking among people younger than 21 years of age.
2. "I'd learned to shut all of it out, because you couldn't travel more than a few miles in Kinshasa without seeing a person dying on the side of the road, and
Someone help me plsss with my math work. the teacher said its eliminating method but i dont understand it.8a+3b=2729-5b=1​
Which equation can be used to find the solution of (1/4)y+1 = 64 -y-1 = 3 y + 1 = 3 y-1 = 3 –y+1=3